C25H36O7 — CID 11812389
CID 11812389 (PubChem CID 11812389) has the molecular formula C25H36O7 and a molecular weight of 448.56 g/mol.
| Compound Name | CID 11812389 |
|---|---|
| PubChem CID | 11812389 |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@H]1C[C@@]2(C)[C@@H](CC[C@@]23OCOC32COCO2)[C@@H]2CC=C3C[C@@H](O)CC[C@]3(C)[C@H]21 |
| InChI | InChI=1S/C25H36O7/c1-15(26)32-20-11-23(3)19(7-9-24(23)25(31-14-29-24)12-28-13-30-25)18-5-4-16-10-17(27)6-8-22(16,2)21(18)20/h4,17-21,27H,5-14H2,1-3H3/t17-,18-,19-,20-,21+,22-,23-,24+,25?/m0/s1 |
| InChIKey | XIEIXXHKMBSVAI-HBLWVBLWSA-N |
| XLogP | 3.30 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|