C28H38O4 — CID 54042297
(10R,13S)-10,13-dimethyl-11-phenylmethoxyspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol (PubChem CID 54042297) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is (10R,13S)-10,13-dimethyl-11-phenylmethoxyspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol.
| Compound Name | (10R,13S)-10,13-dimethyl-11-phenylmethoxyspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol |
|---|---|
| PubChem CID | 54042297 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (10R,13S)-10,13-dimethyl-11-phenylmethoxyspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol |
| SMILES | C[C@]12CCC(O)CC1=CCC1C2C(OCc2ccccc2)C[C@@]2(C)C1CCC21OCCO1 |
| InChI | InChI=1S/C28H38O4/c1-26-12-10-21(29)16-20(26)8-9-22-23-11-13-28(31-14-15-32-28)27(23,2)17-24(25(22)26)30-18-19-6-4-3-5-7-19/h3-8,21-25,29H,9-18H2,1-2H3/t21?,22?,23?,24?,25?,26-,27-/m0/s1 |
| InChIKey | LNENTHOKMLLOKW-GBCOCADJSA-N |
| XLogP | 5.25 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|