C30H44O5 — CID 56953665
(3S,5R,8R,9R,10R,11R,13R,14R)-3-(methoxymethoxy)-10,13-dimethyl-11-phenylmethoxyspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane] (PubChem CID 56953665) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (3S,5R,8R,9R,10R,11R,13R,14R)-3-(methoxymethoxy)-10,13-dimethyl-11-phenylmethoxyspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane].
| Compound Name | (3S,5R,8R,9R,10R,11R,13R,14R)-3-(methoxymethoxy)-10,13-dimethyl-11-phenylmethoxyspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 56953665 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (3S,5R,8R,9R,10R,11R,13R,14R)-3-(methoxymethoxy)-10,13-dimethyl-11-phenylmethoxyspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane] |
| SMILES | COCO[C@H]1CC[C@]2(C)[C@H](CC[C@H]3[C@H]2[C@H](OCc2ccccc2)C[C@]2(C)[C@@H]3CCC23OCCO3)C1 |
| InChI | InChI=1S/C30H44O5/c1-28-13-11-23(33-20-31-3)17-22(28)9-10-24-25-12-14-30(34-15-16-35-30)29(25,2)18-26(27(24)28)32-19-21-7-5-4-6-8-21/h4-8,22-27H,9-20H2,1-3H3/t22-,23+,24-,25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | PCHASGIYSBLMHP-PZMSGMBASA-N |
| XLogP | 5.96 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|