C22H36O3 — CID 86731981
(3R,5S,8S,9S,10S,11S,13S,14S)-3-(methoxymethoxy)-10,13-dimethyl-17-methylidene-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-11-ol (PubChem CID 86731981) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (3R,5S,8S,9S,10S,11S,13S,14S)-3-(methoxymethoxy)-10,13-dimethyl-17-methylidene-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-11-ol.
| Compound Name | (3R,5S,8S,9S,10S,11S,13S,14S)-3-(methoxymethoxy)-10,13-dimethyl-17-methylidene-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-11-ol |
|---|---|
| PubChem CID | 86731981 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (3R,5S,8S,9S,10S,11S,13S,14S)-3-(methoxymethoxy)-10,13-dimethyl-17-methylidene-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-11-ol |
| SMILES | C=C1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](OCOC)CC[C@]4(C)[C@H]3[C@@H](O)C[C@]12C |
| InChI | InChI=1S/C22H36O3/c1-14-5-8-18-17-7-6-15-11-16(25-13-24-4)9-10-21(15,2)20(17)19(23)12-22(14,18)3/h15-20,23H,1,5-13H2,2-4H3/t15-,16+,17-,18-,19-,20+,21-,22+/m0/s1 |
| InChIKey | RCVBJFKRYPSCNX-QJIXBYGTSA-N |
| XLogP | 4.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|