C23H38O3 — CID 90373860
(8S,9R,10R,13S,14S)-3-(methoxymethoxy)-10-(methoxymethyl)-13-methyl-17-methylidene-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 90373860) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-3-(methoxymethoxy)-10-(methoxymethyl)-13-methyl-17-methylidene-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10R,13S,14S)-3-(methoxymethoxy)-10-(methoxymethyl)-13-methyl-17-methylidene-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 90373860 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (8S,9R,10R,13S,14S)-3-(methoxymethoxy)-10-(methoxymethyl)-13-methyl-17-methylidene-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | C=C1CC[C@H]2[C@@H]3CCC4CC(OCOC)CC[C@]4(COC)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C23H38O3/c1-16-5-8-20-19-7-6-17-13-18(26-15-25-4)9-12-23(17,14-24-3)21(19)10-11-22(16,20)2/h17-21H,1,5-15H2,2-4H3/t17?,18?,19-,20-,21+,22+,23+/m0/s1 |
| InChIKey | UEZVWKBNFPWGEV-PUOVXEKKSA-N |
| XLogP | 5.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|