C25H44O — CID 144797492
ethane;(3S,10R,13S,17E)-17-ethylidene-10-(methoxymethyl)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 144797492) has the molecular formula C25H44O and a molecular weight of 360.63 g/mol. Its IUPAC name is ethane;(3S,10R,13S,17E)-17-ethylidene-10-(methoxymethyl)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | ethane;(3S,10R,13S,17E)-17-ethylidene-10-(methoxymethyl)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 144797492 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | ethane;(3S,10R,13S,17E)-17-ethylidene-10-(methoxymethyl)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | C/C=C1\CCC2C3CCC4C[C@@H](C)CC[C@]4(COC)C3CC[C@]12C.CC |
| InChI | InChI=1S/C23H38O.C2H6/c1-5-17-7-9-20-19-8-6-18-14-16(2)10-13-23(18,15-24-4)21(19)11-12-22(17,20)3;1-2/h5,16,18-21H,6-15H2,1-4H3;1-2H3/b17-5+;/t16-,18?,19?,20?,21?,22+,23+;/m0./s1 |
| InChIKey | BYRIFQZDBVJNTN-KCPDIKQCSA-N |
| XLogP | 7.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|