C37H65NO4Si3 — CID 552639
1-[10,13-dimethyl-3,11-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-phenylmethoxy-2-trimethylsilyloxyethanimine (PubChem CID 552639) has the molecular formula C37H65NO4Si3 and a molecular weight of 672.19 g/mol. Its IUPAC name is 1-[10,13-dimethyl-3,11-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-phenylmethoxy-2-trimethylsilyloxyethanimine.
| Compound Name | 1-[10,13-dimethyl-3,11-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-phenylmethoxy-2-trimethylsilyloxyethanimine |
|---|---|
| PubChem CID | 552639 |
| Molecular Formula | C37H65NO4Si3 |
| Molecular Weight | 672.19 g/mol |
| Exact Mass | 671.42 |
| IUPAC Name | 1-[10,13-dimethyl-3,11-bis(trimethylsilyloxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-phenylmethoxy-2-trimethylsilyloxyethanimine |
| SMILES | CC12CC(O[Si](C)(C)C)C3C(CCC4CC(O[Si](C)(C)C)CCC43C)C1CCC2C(CO[Si](C)(C)C)=NOCc1ccccc1 |
| InChI | InChI=1S/C37H65NO4Si3/c1-36-22-21-29(41-44(6,7)8)23-28(36)17-18-30-31-19-20-32(37(31,2)24-34(35(30)36)42-45(9,10)11)33(26-40-43(3,4)5)38-39-25-27-15-13-12-14-16-27/h12-16,28-32,34-35H,17-26H2,1-11H3 |
| InChIKey | DFHWYKMBBIZFHC-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.19 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|