C28H53NO3Si2 — CID 91751618
(Z)-N-ethoxy-1-[(3R,5R,13S,17S)-13-methyl-3-trimethylsilyloxy-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]-2-trimethylsilyloxyethanimine (PubChem CID 91751618) has the molecular formula C28H53NO3Si2 and a molecular weight of 507.91 g/mol. Its IUPAC name is (Z)-N-ethoxy-1-[(3R,5R,13S,17S)-13-methyl-3-trimethylsilyloxy-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]-2-trimethylsilyloxyethanimine.
| Compound Name | (Z)-N-ethoxy-1-[(3R,5R,13S,17S)-13-methyl-3-trimethylsilyloxy-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]-2-trimethylsilyloxyethanimine |
|---|---|
| PubChem CID | 91751618 |
| Molecular Formula | C28H53NO3Si2 |
| Molecular Weight | 507.91 g/mol |
| Exact Mass | 507.36 |
| IUPAC Name | (Z)-N-ethoxy-1-[(3R,5R,13S,17S)-13-methyl-3-trimethylsilyloxy-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]-2-trimethylsilyloxyethanimine |
| SMILES | CCO/N=C(\CO[Si](C)(C)C)[C@H]1CCC2C3CC[C@@H]4C[C@H](O[Si](C)(C)C)CCC4C3CC[C@@]21C |
| InChI | InChI=1S/C28H53NO3Si2/c1-9-30-29-27(19-31-33(3,4)5)26-15-14-25-24-12-10-20-18-21(32-34(6,7)8)11-13-22(20)23(24)16-17-28(25,26)2/h20-26H,9-19H2,1-8H3/b29-27+/t20-,21-,22?,23?,24?,25?,26-,28+/m1/s1 |
| InChIKey | KJZKGCMYIBJAAZ-OVXVQWDBSA-N |
| XLogP | 7.72 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.91 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|