C22H36O3 — CID 145443127
(17S)-3-(ethoxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 145443127) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (17S)-3-(ethoxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | (17S)-3-(ethoxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 145443127 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (17S)-3-(ethoxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | CCOCC1CCC2C(CCC3C2CCC2(C)C3CC[C@@H]2C(=O)O)C1 |
| InChI | InChI=1S/C22H36O3/c1-3-25-13-14-4-6-16-15(12-14)5-7-18-17(16)10-11-22(2)19(18)8-9-20(22)21(23)24/h14-20H,3-13H2,1-2H3,(H,23,24)/t14?,15?,16?,17?,18?,19?,20-,22?/m1/s1 |
| InChIKey | LXHGKWVNIYNOEP-BJBCVGSXSA-N |
| XLogP | 4.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |