C25H44N4O2 — CID 155106526
2-amino-1-[3-[[(Z)-4-(2-aminohydrazinyl)but-3-enoxy]methyl]-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 155106526) has the molecular formula C25H44N4O2 and a molecular weight of 432.65 g/mol. Its IUPAC name is 2-amino-1-[3-[[(Z)-4-(2-aminohydrazinyl)but-3-enoxy]methyl]-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-amino-1-[3-[[(Z)-4-(2-aminohydrazinyl)but-3-enoxy]methyl]-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 155106526 |
| Molecular Formula | C25H44N4O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | 2-amino-1-[3-[[(Z)-4-(2-aminohydrazinyl)but-3-enoxy]methyl]-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC12CCC3C4CCC(COCC/C=C\NNN)CC4CCC3C1CCC2C(=O)CN |
| InChI | InChI=1S/C25H44N4O2/c1-25-11-10-20-19-6-4-17(16-31-13-3-2-12-28-29-27)14-18(19)5-7-21(20)22(25)8-9-23(25)24(30)15-26/h2,12,17-23,28-29H,3-11,13-16,26-27H2,1H3/b12-2- |
| InChIKey | DBFHFCLXVDBVPA-OIXVIMQBSA-N |
| XLogP | 3.29 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|