C21H33BrO — CID 166839719
2-bromo-1-[(3S,8R,10S,13S,17S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 166839719) has the molecular formula C21H33BrO and a molecular weight of 381.40 g/mol. Its IUPAC name is 2-bromo-1-[(3S,8R,10S,13S,17S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-bromo-1-[(3S,8R,10S,13S,17S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 166839719 |
| Molecular Formula | C21H33BrO |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-bromo-1-[(3S,8R,10S,13S,17S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | C[C@H]1CC[C@H]2C(CC[C@@H]3C2CC[C@@]2(C)C3CC[C@@H]2C(=O)CBr)C1 |
| InChI | InChI=1S/C21H33BrO/c1-13-3-5-15-14(11-13)4-6-17-16(15)9-10-21(2)18(17)7-8-19(21)20(23)12-22/h13-19H,3-12H2,1-2H3/t13-,14?,15-,16?,17+,18?,19+,21-/m0/s1 |
| InChIKey | NDRYYFMWKSXKIB-NYJQPEEVSA-N |
| XLogP | 5.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|