C22H35BrO — CID 134180010
2-bromo-1-[(13S,17S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 134180010) has the molecular formula C22H35BrO and a molecular weight of 395.43 g/mol. Its IUPAC name is 2-bromo-1-[(13S,17S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-bromo-1-[(13S,17S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 134180010 |
| Molecular Formula | C22H35BrO |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-bromo-1-[(13S,17S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC1CCC2(C)C(CCC3C2CC[C@@]2(C)C3CC[C@@H]2C(=O)CBr)C1 |
| InChI | InChI=1S/C22H35BrO/c1-14-8-10-21(2)15(12-14)4-5-16-17-6-7-19(20(24)13-23)22(17,3)11-9-18(16)21/h14-19H,4-13H2,1-3H3/t14?,15?,16?,17?,18?,19-,21?,22+/m1/s1 |
| InChIKey | NACJDTKDHMXSHR-FZKZMSRSSA-N |
| XLogP | 6.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|