C23H37BrO — CID 118186239
2-bromo-1-[(2S,3S,5S,8R,9S,10S,13S,14S,17S)-2,3,10,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 118186239) has the molecular formula C23H37BrO and a molecular weight of 409.45 g/mol. Its IUPAC name is 2-bromo-1-[(2S,3S,5S,8R,9S,10S,13S,14S,17S)-2,3,10,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-bromo-1-[(2S,3S,5S,8R,9S,10S,13S,14S,17S)-2,3,10,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 118186239 |
| Molecular Formula | C23H37BrO |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-bromo-1-[(2S,3S,5S,8R,9S,10S,13S,14S,17S)-2,3,10,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | C[C@H]1C[C@@H]2CC[C@@H]3[C@H](CC[C@]4(C)[C@@H](C(=O)CBr)CC[C@@H]34)[C@@]2(C)C[C@@H]1C |
| InChI | InChI=1S/C23H37BrO/c1-14-11-16-5-6-17-18-7-8-20(21(25)13-24)22(18,3)10-9-19(17)23(16,4)12-15(14)2/h14-20H,5-13H2,1-4H3/t14-,15-,16-,17-,18-,19-,20+,22-,23-/m0/s1 |
| InChIKey | ARVMPVRLTQQQHF-RYLPAHKGSA-N |
| XLogP | 6.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|