C25H40BrNO3 — CID 87843708
2-bromo-1-[(2S,3S,5S,8R,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2-morpholin-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 87843708) has the molecular formula C25H40BrNO3 and a molecular weight of 482.50 g/mol. Its IUPAC name is 2-bromo-1-[(2S,3S,5S,8R,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2-morpholin-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-bromo-1-[(2S,3S,5S,8R,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2-morpholin-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 87843708 |
| Molecular Formula | C25H40BrNO3 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 2-bromo-1-[(2S,3S,5S,8R,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2-morpholin-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | C[C@]12C[C@H](C3CNCCO3)[C@@H](O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](C(=O)CBr)CC[C@@H]12 |
| InChI | InChI=1S/C25H40BrNO3/c1-24-8-7-19-16(18(24)5-6-20(24)22(29)13-26)4-3-15-11-21(28)17(12-25(15,19)2)23-14-27-9-10-30-23/h15-21,23,27-28H,3-14H2,1-2H3/t15-,16-,17-,18-,19-,20+,21-,23?,24-,25-/m0/s1 |
| InChIKey | VBOLCHLWFRTHER-DHFGCZDBSA-N |
| XLogP | 4.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|