C21H31BrO — CID 135176504
2-bromo-1-[(2S,5R,11R,15S,16S)-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]ethanone (PubChem CID 135176504) has the molecular formula C21H31BrO and a molecular weight of 379.38 g/mol. Its IUPAC name is 2-bromo-1-[(2S,5R,11R,15S,16S)-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]ethanone.
| Compound Name | 2-bromo-1-[(2S,5R,11R,15S,16S)-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]ethanone |
|---|---|
| PubChem CID | 135176504 |
| Molecular Formula | C21H31BrO |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-bromo-1-[(2S,5R,11R,15S,16S)-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]ethanone |
| SMILES | C[C@]12CCC3[C@@H](CCC4C5C[C@H]5CC[C@@H]43)C1CC[C@@H]2C(=O)CBr |
| InChI | InChI=1S/C21H31BrO/c1-21-9-8-15-13-3-2-12-10-17(12)14(13)4-5-16(15)18(21)6-7-19(21)20(23)11-22/h12-19H,2-11H2,1H3/t12-,13+,14?,15?,16-,17?,18?,19-,21+/m1/s1 |
| InChIKey | BYAWTYXHHARIKN-WDYNDEILSA-N |
| XLogP | 5.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|