C24H35BrO3 — CID 20637857
2-bromo-1-[(3R,5R,8R,9R,10S,13S,14S,17S)-3-hydroxy-3-(4-hydroxybut-1-ynyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 20637857) has the molecular formula C24H35BrO3 and a molecular weight of 451.45 g/mol. Its IUPAC name is 2-bromo-1-[(3R,5R,8R,9R,10S,13S,14S,17S)-3-hydroxy-3-(4-hydroxybut-1-ynyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-bromo-1-[(3R,5R,8R,9R,10S,13S,14S,17S)-3-hydroxy-3-(4-hydroxybut-1-ynyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 20637857 |
| Molecular Formula | C24H35BrO3 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-bromo-1-[(3R,5R,8R,9R,10S,13S,14S,17S)-3-hydroxy-3-(4-hydroxybut-1-ynyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@@](O)(C#CCCO)CC[C@@H]43)[C@@H]1CC[C@@H]2C(=O)CBr |
| InChI | InChI=1S/C24H35BrO3/c1-23-11-8-18-17-9-12-24(28,10-2-3-13-26)14-16(17)4-5-19(18)20(23)6-7-21(23)22(27)15-25/h16-21,26,28H,3-9,11-15H2,1H3/t16-,17+,18-,19-,20+,21-,23+,24-/m1/s1 |
| InChIKey | AVWUXXVAZSGXKN-VLZQRRPNSA-N |
| XLogP | 4.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|