C26H38O2 — CID 118442574
(3R,5S,8R,9R,10S,13S,14S,17S)-3-(2-cyclopropylethynyl)-17-(3-hydroxyprop-1-en-2-yl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 118442574) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is (3R,5S,8R,9R,10S,13S,14S,17S)-3-(2-cyclopropylethynyl)-17-(3-hydroxyprop-1-en-2-yl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5S,8R,9R,10S,13S,14S,17S)-3-(2-cyclopropylethynyl)-17-(3-hydroxyprop-1-en-2-yl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 118442574 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (3R,5S,8R,9R,10S,13S,14S,17S)-3-(2-cyclopropylethynyl)-17-(3-hydroxyprop-1-en-2-yl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=C(CO)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@](O)(C#CC5CC5)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H38O2/c1-17(16-27)23-7-8-24-22-6-5-19-15-26(28,13-9-18-3-4-18)14-11-20(19)21(22)10-12-25(23,24)2/h18-24,27-28H,1,3-8,10-12,14-16H2,2H3/t19-,20-,21+,22+,23+,24-,25+,26+/m0/s1 |
| InChIKey | JYLJRGNRAPISKR-GMZCWBSESA-N |
| XLogP | 4.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|