C26H35ClN2O — CID 118442561
(3R,5S,8R,9R,10S,13S,14S,17S)-3-(2-chloroethynyl)-17-(3-imidazol-1-ylprop-1-en-2-yl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 118442561) has the molecular formula C26H35ClN2O and a molecular weight of 427.03 g/mol. Its IUPAC name is (3R,5S,8R,9R,10S,13S,14S,17S)-3-(2-chloroethynyl)-17-(3-imidazol-1-ylprop-1-en-2-yl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5S,8R,9R,10S,13S,14S,17S)-3-(2-chloroethynyl)-17-(3-imidazol-1-ylprop-1-en-2-yl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 118442561 |
| Molecular Formula | C26H35ClN2O |
| Molecular Weight | 427.03 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (3R,5S,8R,9R,10S,13S,14S,17S)-3-(2-chloroethynyl)-17-(3-imidazol-1-ylprop-1-en-2-yl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=C(Cn1ccnc1)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@](O)(C#CCl)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H35ClN2O/c1-18(16-29-14-13-28-17-29)23-5-6-24-22-4-3-19-15-26(30,11-12-27)10-8-20(19)21(22)7-9-25(23,24)2/h13-14,17,19-24,30H,1,3-10,15-16H2,2H3/t19-,20-,21+,22+,23+,24-,25+,26-/m0/s1 |
| InChIKey | AQTRGVIGBMPBCV-JQDNXEMZSA-N |
| XLogP | 5.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.03 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|