C26H36N2O2 — CID 118442434
1-[(3R,5R,10S,13S,17S)-3-hydroxy-13-methyl-3-prop-1-ynyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-imidazol-1-ylethanone (PubChem CID 118442434) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-[(3R,5R,10S,13S,17S)-3-hydroxy-13-methyl-3-prop-1-ynyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-imidazol-1-ylethanone.
| Compound Name | 1-[(3R,5R,10S,13S,17S)-3-hydroxy-13-methyl-3-prop-1-ynyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-imidazol-1-ylethanone |
|---|---|
| PubChem CID | 118442434 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 1-[(3R,5R,10S,13S,17S)-3-hydroxy-13-methyl-3-prop-1-ynyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-imidazol-1-ylethanone |
| SMILES | CC#C[C@@]1(O)CC[C@@H]2C3CC[C@@]4(C)C(CC[C@@H]4C(=O)Cn4ccnc4)C3CC[C@@H]2C1 |
| InChI | InChI=1S/C26H36N2O2/c1-3-10-26(30)12-9-19-18(15-26)4-5-21-20(19)8-11-25(2)22(21)6-7-23(25)24(29)16-28-14-13-27-17-28/h13-14,17-23,30H,4-9,11-12,15-16H2,1-2H3/t18-,19+,20?,21?,22?,23-,25+,26-/m1/s1 |
| InChIKey | WOROBDPSDPVCHM-OEUYVZCPSA-N |
| XLogP | 4.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|