C27H37N3O2 — CID 118442453
1-[(3R,5R,10S,13S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(triazol-2-yl)ethanone (PubChem CID 118442453) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 1-[(3R,5R,10S,13S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(triazol-2-yl)ethanone.
| Compound Name | 1-[(3R,5R,10S,13S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(triazol-2-yl)ethanone |
|---|---|
| PubChem CID | 118442453 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 1-[(3R,5R,10S,13S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(triazol-2-yl)ethanone |
| SMILES | C[C@]12CCC3C(CC[C@@H]4C[C@@](O)(C#CC5CC5)CC[C@H]34)C1CC[C@@H]2C(=O)Cn1nccn1 |
| InChI | InChI=1S/C27H37N3O2/c1-26-11-9-21-20-10-13-27(32,12-8-18-2-3-18)16-19(20)4-5-22(21)23(26)6-7-24(26)25(31)17-30-28-14-15-29-30/h14-15,18-24,32H,2-7,9-11,13,16-17H2,1H3/t19-,20+,21?,22?,23?,24-,26+,27-/m1/s1 |
| InChIKey | HQJUHJWMHWEYBR-HGDRMOJNSA-N |
| XLogP | 4.26 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|