C25H34ClN3O — CID 118442773
(3S,5R,8R,9R,10S,13S,14S,17S)-3-(2-chloroethynyl)-13-methyl-17-[3-(triazol-2-yl)prop-1-en-2-yl]-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 118442773) has the molecular formula C25H34ClN3O and a molecular weight of 428.02 g/mol. Its IUPAC name is (3S,5R,8R,9R,10S,13S,14S,17S)-3-(2-chloroethynyl)-13-methyl-17-[3-(triazol-2-yl)prop-1-en-2-yl]-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5R,8R,9R,10S,13S,14S,17S)-3-(2-chloroethynyl)-13-methyl-17-[3-(triazol-2-yl)prop-1-en-2-yl]-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 118442773 |
| Molecular Formula | C25H34ClN3O |
| Molecular Weight | 428.02 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | (3S,5R,8R,9R,10S,13S,14S,17S)-3-(2-chloroethynyl)-13-methyl-17-[3-(triazol-2-yl)prop-1-en-2-yl]-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=C(Cn1nccn1)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@](O)(C#CCl)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H34ClN3O/c1-17(16-29-27-13-14-28-29)22-5-6-23-21-4-3-18-15-25(30,11-12-26)10-8-19(18)20(21)7-9-24(22,23)2/h13-14,18-23,30H,1,3-10,15-16H2,2H3/t18-,19+,20-,21-,22-,23+,24-,25-/m1/s1 |
| InChIKey | RRGCOYZXNBSQBA-CLYQZSFASA-N |
| XLogP | 5.03 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.02 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|