C26H37BrO — CID 118442756
(3S,5S,8R,9R,10S,13S,14S,17S)-17-(3-bromoprop-1-en-2-yl)-3-(2-cyclopropylethynyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 118442756) has the molecular formula C26H37BrO and a molecular weight of 445.49 g/mol. Its IUPAC name is (3S,5S,8R,9R,10S,13S,14S,17S)-17-(3-bromoprop-1-en-2-yl)-3-(2-cyclopropylethynyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,8R,9R,10S,13S,14S,17S)-17-(3-bromoprop-1-en-2-yl)-3-(2-cyclopropylethynyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 118442756 |
| Molecular Formula | C26H37BrO |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (3S,5S,8R,9R,10S,13S,14S,17S)-17-(3-bromoprop-1-en-2-yl)-3-(2-cyclopropylethynyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=C(CBr)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@](O)(C#CC5CC5)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H37BrO/c1-17(16-27)23-7-8-24-22-6-5-19-15-26(28,13-9-18-3-4-18)14-11-20(19)21(22)10-12-25(23,24)2/h18-24,28H,1,3-8,10-12,14-16H2,2H3/t19-,20-,21+,22+,23+,24-,25+,26-/m0/s1 |
| InChIKey | DZRSLHANMDQPJQ-JQDNXEMZSA-N |
| XLogP | 6.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|