C25H36O5S2 — CID 71553426
(3R,5R,8R,9R,10S,13S,14S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-13-methyl-17-(2-sulfosulfanylacetyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 71553426) has the molecular formula C25H36O5S2 and a molecular weight of 480.69 g/mol. Its IUPAC name is (3R,5R,8R,9R,10S,13S,14S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-13-methyl-17-(2-sulfosulfanylacetyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3R,5R,8R,9R,10S,13S,14S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-13-methyl-17-(2-sulfosulfanylacetyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 71553426 |
| Molecular Formula | C25H36O5S2 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (3R,5R,8R,9R,10S,13S,14S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-13-methyl-17-(2-sulfosulfanylacetyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@@](O)(C#CC5CC5)CC[C@@H]43)[C@@H]1CC[C@@H]2C(=O)CSS(=O)(=O)O |
| InChI | InChI=1S/C25H36O5S2/c1-24-11-9-19-18-10-13-25(27,12-8-16-2-3-16)14-17(18)4-5-20(19)21(24)6-7-22(24)23(26)15-31-32(28,29)30/h16-22,27H,2-7,9-11,13-15H2,1H3,(H,28,29,30)/t17-,18+,19-,20-,21+,22-,24+,25-/m1/s1 |
| InChIKey | RPPZJXDHXGBMJS-DCPTXXHLSA-N |
| XLogP | 4.50 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|