C21H34O5S2 — CID 71553424
(3R,5R,8R,9R,10S,13S,14S,17S)-3-hydroxy-3,13-dimethyl-17-(2-sulfosulfanylacetyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 71553424) has the molecular formula C21H34O5S2 and a molecular weight of 430.63 g/mol. Its IUPAC name is (3R,5R,8R,9R,10S,13S,14S,17S)-3-hydroxy-3,13-dimethyl-17-(2-sulfosulfanylacetyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3R,5R,8R,9R,10S,13S,14S,17S)-3-hydroxy-3,13-dimethyl-17-(2-sulfosulfanylacetyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 71553424 |
| Molecular Formula | C21H34O5S2 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (3R,5R,8R,9R,10S,13S,14S,17S)-3-hydroxy-3,13-dimethyl-17-(2-sulfosulfanylacetyl)-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@@]1(O)CC[C@H]2[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](C(=O)CSS(=O)(=O)O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C21H34O5S2/c1-20(23)9-7-14-13(11-20)3-4-16-15(14)8-10-21(2)17(16)5-6-18(21)19(22)12-27-28(24,25)26/h13-18,23H,3-12H2,1-2H3,(H,24,25,26)/t13-,14+,15-,16-,17+,18-,20-,21+/m1/s1 |
| InChIKey | RVEOFGULIKHOID-MHXSDRORSA-N |
| XLogP | 4.11 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|