C25H38O6S2 — CID 69462190
(3R,5R,10S,13S,17S)-3-hydroxy-3-(4-hydroxybut-1-ynyl)-10,13-dimethyl-17-(2-sulfosulfanylacetyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 69462190) has the molecular formula C25H38O6S2 and a molecular weight of 498.71 g/mol. Its IUPAC name is (3R,5R,10S,13S,17S)-3-hydroxy-3-(4-hydroxybut-1-ynyl)-10,13-dimethyl-17-(2-sulfosulfanylacetyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | (3R,5R,10S,13S,17S)-3-hydroxy-3-(4-hydroxybut-1-ynyl)-10,13-dimethyl-17-(2-sulfosulfanylacetyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 69462190 |
| Molecular Formula | C25H38O6S2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | (3R,5R,10S,13S,17S)-3-hydroxy-3-(4-hydroxybut-1-ynyl)-10,13-dimethyl-17-(2-sulfosulfanylacetyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@]12CCC3C(CC[C@@H]4C[C@@](O)(C#CCCO)CC[C@]34C)C1CC[C@@H]2C(=O)CSS(=O)(=O)O |
| InChI | InChI=1S/C25H38O6S2/c1-23-12-13-25(28,10-3-4-14-26)15-17(23)5-6-18-19-7-8-21(22(27)16-32-33(29,30)31)24(19,2)11-9-20(18)23/h17-21,26,28H,4-9,11-16H2,1-2H3,(H,29,30,31)/t17-,18?,19?,20?,21-,23+,24+,25-/m1/s1 |
| InChIKey | CXUIIFGBRPWMBF-MBQHNVLLSA-N |
| XLogP | 3.87 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|