C27H38N4O2 — CID 163423553
1-[(3R,9S,14S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-(tetrazol-2-yl)ethanone (PubChem CID 163423553) has the molecular formula C27H38N4O2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 1-[(3R,9S,14S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-(tetrazol-2-yl)ethanone.
| Compound Name | 1-[(3R,9S,14S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-(tetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 163423553 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 1-[(3R,9S,14S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-(tetrazol-2-yl)ethanone |
| SMILES | CC12CC[C@](O)(C#CC3CC3)CC1CCC1[C@@H]2CCC2(C)[C@@H](C(=O)Cn3ncnn3)CC[C@@H]12 |
| InChI | InChI=1S/C27H38N4O2/c1-25-13-14-27(33,12-9-18-3-4-18)15-19(25)5-6-20-21-7-8-23(26(21,2)11-10-22(20)25)24(32)16-31-29-17-28-30-31/h17-23,33H,3-8,10-11,13-16H2,1-2H3/t19?,20?,21-,22-,23+,25?,26?,27+/m0/s1 |
| InChIKey | AKNYNMDEUAVRQF-RVYMZYKISA-N |
| XLogP | 4.05 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|