C26H34N4O2 — CID 148787799
1-[(3R,9S,14S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(tetrazol-2-yl)ethanone (PubChem CID 148787799) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 1-[(3R,9S,14S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(tetrazol-2-yl)ethanone.
| Compound Name | 1-[(3R,9S,14S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(tetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 148787799 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 1-[(3R,9S,14S,17S)-3-(2-cyclopropylethynyl)-3-hydroxy-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(tetrazol-2-yl)ethanone |
| SMILES | CC12CC[C@@H]3C4CC[C@](O)(C#CC5CC5)CC4=CCC3[C@@H]1CC[C@@H]2C(=O)Cn1ncnn1 |
| InChI | InChI=1S/C26H34N4O2/c1-25-11-9-20-19-10-13-26(32,12-8-17-2-3-17)14-18(19)4-5-21(20)22(25)6-7-23(25)24(31)15-30-28-16-27-29-30/h4,16-17,19-23,32H,2-3,5-7,9-11,13-15H2,1H3/t19?,20-,21?,22+,23-,25?,26-/m1/s1 |
| InChIKey | OLOPYBHVNJBISC-BDJHAGKESA-N |
| XLogP | 3.58 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|