C24H31ClN4O2 — CID 154993699
1-[(3S,8R,9S,10R,13S,14S,17S)-3-(3-chloroprop-2-ynyl)-3-hydroxy-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(tetrazol-2-yl)ethanone (PubChem CID 154993699) has the molecular formula C24H31ClN4O2 and a molecular weight of 442.99 g/mol. Its IUPAC name is 1-[(3S,8R,9S,10R,13S,14S,17S)-3-(3-chloroprop-2-ynyl)-3-hydroxy-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(tetrazol-2-yl)ethanone.
| Compound Name | 1-[(3S,8R,9S,10R,13S,14S,17S)-3-(3-chloroprop-2-ynyl)-3-hydroxy-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(tetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 154993699 |
| Molecular Formula | C24H31ClN4O2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 1-[(3S,8R,9S,10R,13S,14S,17S)-3-(3-chloroprop-2-ynyl)-3-hydroxy-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(tetrazol-2-yl)ethanone |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@](O)(CC#CCl)CC[C@@H]43)[C@@H]1CC[C@@H]2C(=O)Cn1ncnn1 |
| InChI | InChI=1S/C24H31ClN4O2/c1-23-10-7-18-17-8-11-24(31,9-2-12-25)13-16(17)3-4-19(18)20(23)5-6-21(23)22(30)14-29-27-15-26-28-29/h3,15,17-21,31H,4-11,13-14H2,1H3/t17-,18+,19+,20-,21+,23-,24-/m0/s1 |
| InChIKey | LOZAAESQZUTMFK-DDKQVVKFSA-N |
| XLogP | 3.75 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|