C28H37N3O — CID 118442870
(3S,8R,9S,10R,13S,14S,17S)-3-(2-cyclopropylethynyl)-13-methyl-17-[3-(triazol-2-yl)prop-1-en-2-yl]-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 118442870) has the molecular formula C28H37N3O and a molecular weight of 431.62 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17S)-3-(2-cyclopropylethynyl)-13-methyl-17-[3-(triazol-2-yl)prop-1-en-2-yl]-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,9S,10R,13S,14S,17S)-3-(2-cyclopropylethynyl)-13-methyl-17-[3-(triazol-2-yl)prop-1-en-2-yl]-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 118442870 |
| Molecular Formula | C28H37N3O |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17S)-3-(2-cyclopropylethynyl)-13-methyl-17-[3-(triazol-2-yl)prop-1-en-2-yl]-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=C(Cn1nccn1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@](O)(C#CC5CC5)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H37N3O/c1-19(18-31-29-15-16-30-31)25-7-8-26-24-6-5-21-17-28(32,13-9-20-3-4-20)14-11-22(21)23(24)10-12-27(25,26)2/h5,15-16,20,22-26,32H,1,3-4,6-8,10-12,14,17-18H2,2H3/t22-,23+,24+,25+,26-,27+,28-/m0/s1 |
| InChIKey | CQGNJAIBCMRKAN-WOWQWJCPSA-N |
| XLogP | 5.17 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|