C25H36N2O — CID 118442618
(3R,8R,9S,10R,13S,14S,17S)-17-(3-imidazol-1-ylprop-1-en-2-yl)-3,13-dimethyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 118442618) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is (3R,8R,9S,10R,13S,14S,17S)-17-(3-imidazol-1-ylprop-1-en-2-yl)-3,13-dimethyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,8R,9S,10R,13S,14S,17S)-17-(3-imidazol-1-ylprop-1-en-2-yl)-3,13-dimethyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 118442618 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | (3R,8R,9S,10R,13S,14S,17S)-17-(3-imidazol-1-ylprop-1-en-2-yl)-3,13-dimethyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=C(Cn1ccnc1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@](C)(O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H36N2O/c1-17(15-27-13-12-26-16-27)22-6-7-23-21-5-4-18-14-24(2,28)10-8-19(18)20(21)9-11-25(22,23)3/h4,12-13,16,19-23,28H,1,5-11,14-15H2,2-3H3/t19-,20+,21+,22+,23-,24+,25+/m0/s1 |
| InChIKey | VXDFKKALDRJXDR-VQCHMSJISA-N |
| XLogP | 5.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|