C23H29F2N3O2 — CID 162591889
1-[(1S,2R,5R,11R,12S,15S,16S)-6,6-difluoro-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-8-enyl]-2-(triazol-2-yl)ethanone (PubChem CID 162591889) has the molecular formula C23H29F2N3O2 and a molecular weight of 417.50 g/mol. Its IUPAC name is 1-[(1S,2R,5R,11R,12S,15S,16S)-6,6-difluoro-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-8-enyl]-2-(triazol-2-yl)ethanone.
| Compound Name | 1-[(1S,2R,5R,11R,12S,15S,16S)-6,6-difluoro-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-8-enyl]-2-(triazol-2-yl)ethanone |
|---|---|
| PubChem CID | 162591889 |
| Molecular Formula | C23H29F2N3O2 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 1-[(1S,2R,5R,11R,12S,15S,16S)-6,6-difluoro-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-8-enyl]-2-(triazol-2-yl)ethanone |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C5C(F)(F)[C@@]5(O)CC[C@@H]43)[C@@H]1CC[C@@H]2C(=O)Cn1nccn1 |
| InChI | InChI=1S/C23H29F2N3O2/c1-21-8-6-13-14-7-9-22(30)20(23(22,24)25)16(14)3-2-15(13)17(21)4-5-18(21)19(29)12-28-26-10-11-27-28/h3,10-11,13-15,17-18,20,30H,2,4-9,12H2,1H3/t13-,14-,15-,17+,18-,20?,21+,22-/m1/s1 |
| InChIKey | OTKKAOHLAHVUPY-XFLJAFNLSA-N |
| XLogP | 3.64 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|