C23H34FN3O — CID 144966433
1-(6-fluoro-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-(triazol-2-yl)ethanone (PubChem CID 144966433) has the molecular formula C23H34FN3O and a molecular weight of 387.54 g/mol. Its IUPAC name is 1-(6-fluoro-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-(triazol-2-yl)ethanone.
| Compound Name | 1-(6-fluoro-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-(triazol-2-yl)ethanone |
|---|---|
| PubChem CID | 144966433 |
| Molecular Formula | C23H34FN3O |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | 1-(6-fluoro-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-(triazol-2-yl)ethanone |
| SMILES | CC1CCC2C(C1)C(F)CC1C2CCC2(C)C(C(=O)Cn3nccn3)CCC12 |
| InChI | InChI=1S/C23H34FN3O/c1-14-3-4-15-16-7-8-23(2)19(17(16)12-21(24)18(15)11-14)5-6-20(23)22(28)13-27-25-9-10-26-27/h9-10,14-21H,3-8,11-13H2,1-2H3 |
| InChIKey | BHWIEAZABKYTIV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |