C24H33N3O2 — CID 166862545
1-[(2S,5S,8R,11S,12S,15S,16S)-5-hydroxy-2,16-dimethyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-1(18)-enyl]-2-(triazol-2-yl)ethanone (PubChem CID 166862545) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-[(2S,5S,8R,11S,12S,15S,16S)-5-hydroxy-2,16-dimethyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-1(18)-enyl]-2-(triazol-2-yl)ethanone.
| Compound Name | 1-[(2S,5S,8R,11S,12S,15S,16S)-5-hydroxy-2,16-dimethyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-1(18)-enyl]-2-(triazol-2-yl)ethanone |
|---|---|
| PubChem CID | 166862545 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 1-[(2S,5S,8R,11S,12S,15S,16S)-5-hydroxy-2,16-dimethyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-1(18)-enyl]-2-(triazol-2-yl)ethanone |
| SMILES | C[C@]12CC=C3[C@@H](CC[C@@H]4C5C[C@@]5(O)CC[C@]34C)[C@@H]1CC[C@@H]2C(=O)Cn1nccn1 |
| InChI | InChI=1S/C24H33N3O2/c1-22-8-7-17-15(3-4-18-20-13-24(20,29)10-9-23(17,18)2)16(22)5-6-19(22)21(28)14-27-25-11-12-26-27/h7,11-12,15-16,18-20,29H,3-6,8-10,13-14H2,1-2H3/t15-,16-,18+,19+,20?,22-,23+,24-/m0/s1 |
| InChIKey | AVWBUCNVELNBDB-JDPGHNQZSA-N |
| XLogP | 3.79 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|