C27H42N2O2 — CID 163934304
ethane;1-[(3R,5R,8S,10S,13S,14S,17S)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-pyrazol-1-ylethanone (PubChem CID 163934304) has the molecular formula C27H42N2O2 and a molecular weight of 426.65 g/mol. Its IUPAC name is ethane;1-[(3R,5R,8S,10S,13S,14S,17S)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-pyrazol-1-ylethanone.
| Compound Name | ethane;1-[(3R,5R,8S,10S,13S,14S,17S)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-pyrazol-1-ylethanone |
|---|---|
| PubChem CID | 163934304 |
| Molecular Formula | C27H42N2O2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | ethane;1-[(3R,5R,8S,10S,13S,14S,17S)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-pyrazol-1-ylethanone |
| SMILES | CC.C[C@@]1(O)CC[C@]2(C)C3=CC[C@]4(C)[C@@H](C(=O)Cn5cccn5)CC[C@H]4[C@@H]3CC[C@@H]2C1 |
| InChI | InChI=1S/C25H36N2O2.C2H6/c1-23(29)11-12-24(2)17(15-23)5-6-18-19-7-8-21(25(19,3)10-9-20(18)24)22(28)16-27-14-4-13-26-27;1-2/h4,9,13-14,17-19,21,29H,5-8,10-12,15-16H2,1-3H3;1-2H3/t17-,18+,19+,21-,23-,24+,25+;/m1./s1 |
| InChIKey | RLJHCQKDNHIPLP-HCRHGMKLSA-N |
| XLogP | 5.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|