C22H32O2 — CID 146522523
1-[(2S,5S,8S,11S,15S,16S)-5-hydroxy-2,16-dimethyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-1(18)-enyl]ethanone (PubChem CID 146522523) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 1-[(2S,5S,8S,11S,15S,16S)-5-hydroxy-2,16-dimethyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-1(18)-enyl]ethanone.
| Compound Name | 1-[(2S,5S,8S,11S,15S,16S)-5-hydroxy-2,16-dimethyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-1(18)-enyl]ethanone |
|---|---|
| PubChem CID | 146522523 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 1-[(2S,5S,8S,11S,15S,16S)-5-hydroxy-2,16-dimethyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-1(18)-enyl]ethanone |
| SMILES | CC(=O)[C@H]1CCC2[C@@H]3CC[C@H]4C5C[C@@]5(O)CC[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C22H32O2/c1-13(23)15-6-7-16-14-4-5-18-19-12-22(19,24)11-10-21(18,3)17(14)8-9-20(15,16)2/h8,14-16,18-19,24H,4-7,9-12H2,1-3H3/t14-,15+,16?,18-,19?,20+,21+,22-/m0/s1 |
| InChIKey | GSMOJFYGJQOOII-IOCOCGNFSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|