C25H40O2 — CID 167490049
(4R)-4-[(3S,5S,8S,10S,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanal (PubChem CID 167490049) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is (4R)-4-[(3S,5S,8S,10S,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanal.
| Compound Name | (4R)-4-[(3S,5S,8S,10S,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanal |
|---|---|
| PubChem CID | 167490049 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (4R)-4-[(3S,5S,8S,10S,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanal |
| SMILES | C[C@H](CCC=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@](C)(O)CC[C@]4(C)C3=CCC12C |
| InChI | InChI=1S/C25H40O2/c1-17(6-5-15-26)20-9-10-21-19-8-7-18-16-23(2,27)13-14-24(18,3)22(19)11-12-25(20,21)4/h11,15,17-21,27H,5-10,12-14,16H2,1-4H3/t17-,18+,19+,20-,21+,23+,24+,25?/m1/s1 |
| InChIKey | UXUHXPXHBHPFSA-UUCMDEEMSA-N |
| XLogP | 5.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|