C24H39OP — CID 58320998
(3R,5R,8S,10S,13R,14S)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-3-phosphoroso-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 58320998) has the molecular formula C24H39OP and a molecular weight of 374.55 g/mol. Its IUPAC name is (3R,5R,8S,10S,13R,14S)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-3-phosphoroso-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3R,5R,8S,10S,13R,14S)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-3-phosphoroso-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 58320998 |
| Molecular Formula | C24H39OP |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | (3R,5R,8S,10S,13R,14S)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-3-phosphoroso-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCC[C@@H](C)C1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](P=O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C24H39OP/c1-5-6-16(2)20-9-10-21-19-8-7-17-15-18(26-25)11-13-23(17,3)22(19)12-14-24(20,21)4/h12,16-21H,5-11,13-15H2,1-4H3/t16-,17-,18-,19+,20?,21+,23+,24-/m1/s1 |
| InChIKey | WRRQADRYILPUAL-BZYCZHDKSA-N |
| XLogP | 7.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|