C29H45NO2 — CID 167490260
1-[(1S,4R)-1-hydroxy-4-[(3S,5S,8S,10S,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentyl]cyclopropane-1-carbonitrile (PubChem CID 167490260) has the molecular formula C29H45NO2 and a molecular weight of 439.68 g/mol. Its IUPAC name is 1-[(1S,4R)-1-hydroxy-4-[(3S,5S,8S,10S,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[(1S,4R)-1-hydroxy-4-[(3S,5S,8S,10S,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 167490260 |
| Molecular Formula | C29H45NO2 |
| Molecular Weight | 439.68 g/mol |
| Exact Mass | 439.35 |
| IUPAC Name | 1-[(1S,4R)-1-hydroxy-4-[(3S,5S,8S,10S,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentyl]cyclopropane-1-carbonitrile |
| SMILES | C[C@H](CC[C@H](O)C1(C#N)CC1)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@](C)(O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C29H45NO2/c1-19(5-10-25(31)29(18-30)15-16-29)22-8-9-23-21-7-6-20-17-26(2,32)13-14-27(20,3)24(21)11-12-28(22,23)4/h11,19-23,25,31-32H,5-10,12-17H2,1-4H3/t19-,20+,21+,22-,23+,25+,26+,27+,28-/m1/s1 |
| InChIKey | FAGBVGKYTSAMBB-OTBLELRWSA-N |
| XLogP | 6.40 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.68 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|