C30H47NO2 — CID 167490174
1-[(1S,4R)-1-hydroxy-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentyl]cyclobutane-1-carbonitrile (PubChem CID 167490174) has the molecular formula C30H47NO2 and a molecular weight of 453.71 g/mol. Its IUPAC name is 1-[(1S,4R)-1-hydroxy-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentyl]cyclobutane-1-carbonitrile.
| Compound Name | 1-[(1S,4R)-1-hydroxy-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentyl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 167490174 |
| Molecular Formula | C30H47NO2 |
| Molecular Weight | 453.71 g/mol |
| Exact Mass | 453.36 |
| IUPAC Name | 1-[(1S,4R)-1-hydroxy-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentyl]cyclobutane-1-carbonitrile |
| SMILES | C[C@H](CC[C@H](O)C1(C#N)CCC1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H47NO2/c1-20(6-11-26(32)30(19-31)13-5-14-30)23-9-10-24-22-8-7-21-18-27(2,33)16-17-28(21,3)25(22)12-15-29(23,24)4/h7,20,22-26,32-33H,5-6,8-18H2,1-4H3/t20-,22+,23-,24+,25+,26+,27+,28+,29-/m1/s1 |
| InChIKey | QXJFPAIYJBPZAL-TWOCBBPNSA-N |
| XLogP | 6.79 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.71 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|