C21H31OP — CID 123878032
(3R,10S,13S)-17-ethylidene-10,13-dimethyl-3-phosphoroso-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 123878032) has the molecular formula C21H31OP and a molecular weight of 330.45 g/mol. Its IUPAC name is (3R,10S,13S)-17-ethylidene-10,13-dimethyl-3-phosphoroso-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | (3R,10S,13S)-17-ethylidene-10,13-dimethyl-3-phosphoroso-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 123878032 |
| Molecular Formula | C21H31OP |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (3R,10S,13S)-17-ethylidene-10,13-dimethyl-3-phosphoroso-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | CC=C1CCC2C3CCC4C[C@H](P=O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C21H31OP/c1-4-14-6-8-18-17-7-5-15-13-16(23-22)9-11-21(15,3)19(17)10-12-20(14,18)2/h4,10,15-18H,5-9,11-13H2,1-3H3/t15?,16-,17?,18?,20-,21+/m1/s1 |
| InChIKey | KZCOYCDFMPROGF-HXCHIXHASA-N |
| XLogP | 6.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|