C26H31IO3 — CID 163071573
[(3R,5S,8R,10S,13R,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-iodobenzoate (PubChem CID 163071573) has the molecular formula C26H31IO3 and a molecular weight of 518.44 g/mol. Its IUPAC name is [(3R,5S,8R,10S,13R,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-iodobenzoate.
| Compound Name | [(3R,5S,8R,10S,13R,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-iodobenzoate |
|---|---|
| PubChem CID | 163071573 |
| Molecular Formula | C26H31IO3 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | [(3R,5S,8R,10S,13R,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-iodobenzoate |
| SMILES | C[C@@]12CC=C3[C@H](CC[C@H]4C[C@H](OC(=O)c5cccc(I)c5)CC[C@]34C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C26H31IO3/c1-25-12-10-19(30-24(29)16-4-3-5-18(27)14-16)15-17(25)6-7-20-21-8-9-23(28)26(21,2)13-11-22(20)25/h3-5,11,14,17,19-21H,6-10,12-13,15H2,1-2H3/t17-,19+,20+,21-,25-,26+/m0/s1 |
| InChIKey | MYHSEBYRFQDMAH-OSZMHEIBSA-N |
| XLogP | 6.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|