C22H34O3 — CID 146522529
(3R,5S,8S,10S,13S,14S)-3-(ethoxymethyl)-3-hydroxy-10,13-dimethyl-2,4,5,6,7,8,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 146522529) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (3R,5S,8S,10S,13S,14S)-3-(ethoxymethyl)-3-hydroxy-10,13-dimethyl-2,4,5,6,7,8,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,5S,8S,10S,13S,14S)-3-(ethoxymethyl)-3-hydroxy-10,13-dimethyl-2,4,5,6,7,8,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 146522529 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (3R,5S,8S,10S,13S,14S)-3-(ethoxymethyl)-3-hydroxy-10,13-dimethyl-2,4,5,6,7,8,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCOC[C@@]1(O)CC[C@]2(C)C3=CC[C@]4(C)C(=O)CC[C@H]4[C@@H]3CC[C@H]2C1 |
| InChI | InChI=1S/C22H34O3/c1-4-25-14-22(24)12-11-20(2)15(13-22)5-6-16-17-7-8-19(23)21(17,3)10-9-18(16)20/h9,15-17,24H,4-8,10-14H2,1-3H3/t15-,16-,17-,20-,21-,22+/m0/s1 |
| InChIKey | QTCMYGNNVDRNTQ-DGFKWQBSSA-N |
| XLogP | 4.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|