C20H28O4 — CID 90990001
(8'S,10'S,13'S,14'S)-10'-hydroxy-4,13'-dimethylspiro[1,3-dioxetane-2,3'-2,4,5,6,7,8,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one (PubChem CID 90990001) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (8'S,10'S,13'S,14'S)-10'-hydroxy-4,13'-dimethylspiro[1,3-dioxetane-2,3'-2,4,5,6,7,8,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one.
| Compound Name | (8'S,10'S,13'S,14'S)-10'-hydroxy-4,13'-dimethylspiro[1,3-dioxetane-2,3'-2,4,5,6,7,8,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
|---|---|
| PubChem CID | 90990001 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (8'S,10'S,13'S,14'S)-10'-hydroxy-4,13'-dimethylspiro[1,3-dioxetane-2,3'-2,4,5,6,7,8,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
| SMILES | CC1OC2(CC[C@@]3(O)C4=CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CCC3C2)O1 |
| InChI | InChI=1S/C20H28O4/c1-12-23-19(24-12)9-10-20(22)13(11-19)3-4-14-15-5-6-17(21)18(15,2)8-7-16(14)20/h7,12-15,22H,3-6,8-11H2,1-2H3/t12?,13?,14-,15-,18-,19?,20-/m0/s1 |
| InChIKey | UEEXWQQNRRKYQW-XIUMRXQCSA-N |
| XLogP | 3.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|