C23H32O4 — CID 13340395
5,5,5'-trimethylspiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-one (PubChem CID 13340395) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 5,5,5'-trimethylspiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-one.
| Compound Name | 5,5,5'-trimethylspiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-one |
|---|---|
| PubChem CID | 13340395 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 5,5,5'-trimethylspiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-one |
| SMILES | CC1(C)COC2(CCC34OC3(CCC3C4=CCC4(C)C(=O)CCC34)C2)OC1 |
| InChI | InChI=1S/C23H32O4/c1-19(2)13-25-22(26-14-19)10-11-23-17-7-8-20(3)16(4-5-18(20)24)15(17)6-9-21(23,12-22)27-23/h7,15-16H,4-6,8-14H2,1-3H3 |
| InChIKey | OXONFGNWQHJDNQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|