C24H32O4 — CID 59204340
CID 59204340 (PubChem CID 59204340) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol.
| Compound Name | CID 59204340 |
|---|---|
| PubChem CID | 59204340 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | — |
| SMILES | C=C1CCO[C@]12CC[C@H]1[C@@H]3CC[C@@]45CC6(CC[C@@]4(O5)C3=CC[C@@]12C)OCCO6 |
| InChI | InChI=1S/C24H32O4/c1-16-6-12-27-23(16)9-5-18-17-3-8-21-15-22(25-13-14-26-22)10-11-24(21,28-21)19(17)4-7-20(18,23)2/h4,17-18H,1,3,5-15H2,2H3/t17-,18-,20-,21+,23+,24+/m0/s1 |
| InChIKey | KZHBWXRRTYOWAW-FSQCBZKWSA-N |
| XLogP | 4.29 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|