C23H34O6 — CID 91037506
(1'S,5'S,6'R,9'S,10'S)-6'-(1-hydroxy-2-methoxyethyl)-5'-methylspiro[1,3-dioxolane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-ol (PubChem CID 91037506) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is (1'S,5'S,6'R,9'S,10'S)-6'-(1-hydroxy-2-methoxyethyl)-5'-methylspiro[1,3-dioxolane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-ol.
| Compound Name | (1'S,5'S,6'R,9'S,10'S)-6'-(1-hydroxy-2-methoxyethyl)-5'-methylspiro[1,3-dioxolane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-ol |
|---|---|
| PubChem CID | 91037506 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (1'S,5'S,6'R,9'S,10'S)-6'-(1-hydroxy-2-methoxyethyl)-5'-methylspiro[1,3-dioxolane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-ol |
| SMILES | COCC(O)[C@@]1(O)CC[C@H]2[C@@H]3CCC45CC6(CC[C@]4(O5)C3=CC[C@@]21C)OCCO6 |
| InChI | InChI=1S/C23H34O6/c1-19-6-4-17-15(16(19)5-8-22(19,25)18(24)13-26-2)3-7-20-14-21(27-11-12-28-21)9-10-23(17,20)29-20/h4,15-16,18,24-25H,3,5-14H2,1-2H3/t15-,16-,18?,19-,20?,22-,23-/m0/s1 |
| InChIKey | RGHRQMKFGDRVKQ-PBKGQFBVSA-N |
| XLogP | 2.32 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|