C24H35NO4Si — CID 89398085
(1'R,5'S,6'R,13'R)-5'-methyl-6'-trimethylsilyloxyspiro[1,3-dioxolane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-carbonitrile (PubChem CID 89398085) has the molecular formula C24H35NO4Si and a molecular weight of 429.63 g/mol. Its IUPAC name is (1'R,5'S,6'R,13'R)-5'-methyl-6'-trimethylsilyloxyspiro[1,3-dioxolane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-carbonitrile.
| Compound Name | (1'R,5'S,6'R,13'R)-5'-methyl-6'-trimethylsilyloxyspiro[1,3-dioxolane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-carbonitrile |
|---|---|
| PubChem CID | 89398085 |
| Molecular Formula | C24H35NO4Si |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (1'R,5'S,6'R,13'R)-5'-methyl-6'-trimethylsilyloxyspiro[1,3-dioxolane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-carbonitrile |
| SMILES | C[C@]12CC=C3C(CC[C@@]45CC6(CC[C@@]34O5)OCCO6)C1CC[C@@]2(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C24H35NO4Si/c1-20-8-6-19-17(18(20)7-10-22(20,16-25)29-30(2,3)4)5-9-21-15-23(26-13-14-27-23)11-12-24(19,21)28-21/h6,17-18H,5,7-15H2,1-4H3/t17?,18?,20-,21+,22-,24+/m0/s1 |
| InChIKey | PSDXUYHICGJWHN-ZYRZAMBRSA-N |
| XLogP | 4.69 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|