C29H44O5Si — CID 10983923
(1'R,5'S,6'S,7'R,9'S,10'S,13'R)-7'-[tert-butyl(dimethyl)silyl]oxy-5'-methyl-6'-prop-1-ynylspiro[1,3-dioxolane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-ol (PubChem CID 10983923) has the molecular formula C29H44O5Si and a molecular weight of 500.75 g/mol. Its IUPAC name is (1'R,5'S,6'S,7'R,9'S,10'S,13'R)-7'-[tert-butyl(dimethyl)silyl]oxy-5'-methyl-6'-prop-1-ynylspiro[1,3-dioxolane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-ol.
| Compound Name | (1'R,5'S,6'S,7'R,9'S,10'S,13'R)-7'-[tert-butyl(dimethyl)silyl]oxy-5'-methyl-6'-prop-1-ynylspiro[1,3-dioxolane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-ol |
|---|---|
| PubChem CID | 10983923 |
| Molecular Formula | C29H44O5Si |
| Molecular Weight | 500.75 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | (1'R,5'S,6'S,7'R,9'S,10'S,13'R)-7'-[tert-butyl(dimethyl)silyl]oxy-5'-methyl-6'-prop-1-ynylspiro[1,3-dioxolane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-ol |
| SMILES | CC#C[C@]1(O)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]2[C@@H]3CC[C@@]45CC6(CC[C@@]4(O5)C3=CC[C@@]21C)OCCO6 |
| InChI | InChI=1S/C29H44O5Si/c1-8-11-28(30)23(33-35(6,7)24(2,3)4)18-22-20-9-13-26-19-27(31-16-17-32-27)14-15-29(26,34-26)21(20)10-12-25(22,28)5/h10,20,22-23,30H,9,12-19H2,1-7H3/t20-,22+,23-,25+,26-,28+,29-/m1/s1 |
| InChIKey | JIJLQVAAEJDNLY-RCBWVJGHSA-N |
| XLogP | 5.33 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.75 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|