C20H25O4+ — CID 123309809
CID 123309809 (PubChem CID 123309809) has the molecular formula C20H25O4+ and a molecular weight of 329.42 g/mol.
| Compound Name | CID 123309809 |
|---|---|
| PubChem CID | 123309809 |
| Molecular Formula | C20H25O4+ |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | — |
| SMILES | C[C@]12CC=C3C(CC[C@@]45CC6(CC[C@@]34O5)OCCO6)C1C[CH+]C2=O |
| InChI | InChI=1S/C20H25O4/c1-17-6-5-15-13(14(17)2-3-16(17)21)4-7-18-12-19(22-10-11-23-19)8-9-20(15,18)24-18/h3,5,13-14H,2,4,6-12H2,1H3/q+1/t13?,14?,17-,18+,20+/m0/s1 |
| InChIKey | NGIULFHCQJYUGA-XCLTWERCSA-N |
| XLogP | 2.96 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|