C25H33F5O4 — CID 59780402
(1'R,5'S,6'S,9'S,10'S,13'R)-5,5,5'-trimethyl-6'-(1,1,2,2,2-pentafluoroethyl)spiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-ol (PubChem CID 59780402) has the molecular formula C25H33F5O4 and a molecular weight of 492.53 g/mol. Its IUPAC name is (1'R,5'S,6'S,9'S,10'S,13'R)-5,5,5'-trimethyl-6'-(1,1,2,2,2-pentafluoroethyl)spiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-ol.
| Compound Name | (1'R,5'S,6'S,9'S,10'S,13'R)-5,5,5'-trimethyl-6'-(1,1,2,2,2-pentafluoroethyl)spiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-ol |
|---|---|
| PubChem CID | 59780402 |
| Molecular Formula | C25H33F5O4 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | (1'R,5'S,6'S,9'S,10'S,13'R)-5,5,5'-trimethyl-6'-(1,1,2,2,2-pentafluoroethyl)spiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-ol |
| SMILES | CC1(C)COC2(CC[C@]34O[C@]3(CC[C@@H]3C4=CC[C@@]4(C)[C@H]3CC[C@@]4(O)C(F)(F)C(F)(F)F)C2)OC1 |
| InChI | InChI=1S/C25H33F5O4/c1-18(2)13-32-21(33-14-18)10-11-22-17-5-7-19(3)16(15(17)4-8-20(22,12-21)34-22)6-9-23(19,31)24(26,27)25(28,29)30/h5,15-16,31H,4,6-14H2,1-3H3/t15-,16-,19-,20+,22+,23-/m0/s1 |
| InChIKey | GWHXRIGQWKHVJL-WEKVZFDUSA-N |
| XLogP | 5.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|